इमातिनिब

विकिपिडिया नं
Jump to navigation Jump to search

{{drugbox | verifiedrevid = 459451238 | IUPAC_name = 4-[(4-methylpiperazin-1-yl)methyl]-N-(4-methyl-3-{[4-(pyridin-3-yl)pyrimidin-2-yl]amino}phenyl)benzamide | image = Imatinib2DACS.svg | width = 300 | image2 = Imatinib3Dan.gif | width2 = 250 | tradename = Gleevec, Glivec | Drugs.com = Template:Drugs.com | MedlinePlus = a606018 | licence_EU = Glivec | licence_US = IMATINIB | pregnancy_AU = D | pregnancy_US = D | legal_AU = S4 | legal_CA = Rx-only | legal_UK = POM | legal_US = Rx-only | routes_of_administration = Oral

| bioavailability = 98% | protein_bound = 95% | metabolism = Hepatic (mainly CYP3A4-mediated) | elimination_half-life = 18 hours (imatinib)
40 hours (active metabolite) | excretion = Faecal (68%) and renal (13%)

| CASNo_Ref = Template:Cascite | CAS_number_Ref = Template:Cascite | CAS_number = 152459-95-5 | CAS_supplemental =
Template:CAS(mesilate) | ATC_prefix = L01 | ATC_suffix = XE01 | PubChem = 5291 | DrugBank_Ref = Template:Drugbankcite

| DrugBank = DB00619

| ChemSpiderID_Ref = Template:Chemspidercite | ChemSpiderID = 5101 | UNII_Ref = Template:Fdacite | UNII = BKJ8M8G5HI | KEGG_Ref = Template:Keggcite | KEGG = D08066 | ChEBI_Ref = Template:Ebicite | ChEBI = 45783 | ChEMBL_Ref = Template:Ebicite | ChEMBL = 941

| C=29 | H=31 | N=7 | O=1 | molecular_weight = 493.603 g/mol
589.7 g/mol (mesilate) | smiles = Cc1ccc(cc1Nc2nccc(n2)c3cccnc3)NC(=O)c4ccc(cc4)CN5CCN(CC5)C | InChI = 1/C29H31N7O/c1-21-5-10-25(18-27(21)34-29-31-13-11-26(33-29)24-4-3-12-30-19-24)32-28(37)23-8-6-22(7-9-23)20-36-16-14-35(2)15-17-36/h3-13,18-19H,14-17,20H2,1-2H3,(H,32,37)(H,31,33,34) | InChIKey = KTUFNOKKBVMGRW-UHFFFAOYAJ | StdInChI_Ref = Template:Stdinchicite | StdInChI = 1S/C29H31N7O/c1-21-5-10-25(18-27(21)34-29-31-13-11-26(33-29)24-4-3-12-30-19-24)32-28(37)23-8-6-22(7-9-23)20-36-16-14-35(2)15-17-36/h3-13,18-19H,14-17,20H2,1-2H3,(H,32,37)(H,31,33,34) | StdInChIKey_Ref = Template:Stdinchicite | StdInChIKey = KTUFNOKKBVMGRW-UHFFFAOYSA-N }} इमातिनिब वा ग्लिभेक (ब्रान्दनेम) छता वासः ख। थ्व वासः ताइरोसिन काइनेज इन्हिबितर ख। थ्व वासःयात यक्व क्यान्सरय् छ्यलिगुया। थ्व वासः फिलादेल्फिया क्रोमोजम पोजितिभ (Ph+) क्रोनिक माइलोजेनस ल्युकेमिया (CML)य् थ्व वासःया ज्याया निंतिं सिक्क नां जा। [१] मेमेगु ताइरोजिन काइनेज इन्हिबितरतेसं थें हे थ्व वासलं नं ताइरोजिन काइनेजयात पनि। थ्व वासलं BCR-Ablया फस्फोरिलेसन यायेबी मखु। थ्व फोस्फरिलेसनं न्ह्यथनिगु सिग्नलिङ कास्केदं जुइगु क्यान्सर विकास थ्व वासःया पनेज्यांयाना जुइमखु। थ्व कथं थ्व वासलं क्यान्सरय् ज्या याइ। [२] BCR-Abl ताइरोजिन काइनेज इन्जाइम क्यान्सर सेलय् जक्क दइगु व साधारण सेलय् मदइगु जूगुलिं थ्व वासलं तार्गेतेद थेरापी अर्थात क्यान्सर सेलयात जक्क "तारगेत" या व साधारण सेलतयेत असर मया।[३] थ्व परिपेक्षय् इमातिनिब हलिंया दकलय् न्हापांगु तार्गेतेद थेरापीया वासलय् छता ख। थ्व वासःयात क्यान्सर चिकित्सा रिसर्चया पारादाइमया रुपय् नालिगु या।[४]

लिधंसा[सम्पादन]

  1. Novartis Pharma AG. Gleevec® (imatinib mesylate) tablets prescribing information. East Hanover, NJ; 2006 Sep. Anon. Drugs of choice for cancer. Treat Guidel Med Lett. 2003; 1:41–52
  2. Goldman JM, Melo JV (October 2003). "Chronic myeloid leukemia--advances in biology and new approaches to treatment". N. Engl. J. Med. 349 (15): 1451–64. DOI:10.1056/NEJMra020777. PMID 14534339. 
  3. Fausel, C. Targeted chronic myeloid leukemia therapy: Seeking a cure. Am J Health Syst Pharm 64, S9-15 (2007)
  4. Stegmeier F, Warmuth M, Sellers WR, Dorsch M (May 2010). "Targeted cancer therapies in the twenty-first century: lessons from imatinib". Clin. Pharmacol. Ther. 87 (5): 543–52. DOI:10.1038/clpt.2009.297. PMID 20237469.